C14H8F3NS — CID 139219182
8-(trifluoromethyl)benzo[b][1,4]benzothiazepine (PubChem CID 139219182) has the molecular formula C14H8F3NS and a molecular weight of 279.29 g/mol. Its IUPAC name is 8-(trifluoromethyl)benzo[b][1,4]benzothiazepine.
| Compound Name | 8-(trifluoromethyl)benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 139219182 |
| Molecular Formula | C14H8F3NS |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 8-(trifluoromethyl)benzo[b][1,4]benzothiazepine |
| SMILES | FC(F)(F)c1ccc2c(c1)C=Nc1ccccc1S2 |
| InChI | InChI=1S/C14H8F3NS/c15-14(16,17)10-5-6-12-9(7-10)8-18-11-3-1-2-4-13(11)19-12/h1-8H |
| InChIKey | GOPPCWYCSRHGGL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |