C14H9ClN2OS — CID 86711153
6-chlorobenzo[b][1,4]benzothiazepine-9-carboxamide (PubChem CID 86711153) has the molecular formula C14H9ClN2OS and a molecular weight of 288.76 g/mol. Its IUPAC name is 6-chlorobenzo[b][1,4]benzothiazepine-9-carboxamide.
| Compound Name | 6-chlorobenzo[b][1,4]benzothiazepine-9-carboxamide |
|---|---|
| PubChem CID | 86711153 |
| Molecular Formula | C14H9ClN2OS |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 6-chlorobenzo[b][1,4]benzothiazepine-9-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)Sc1ccccc1N=C2Cl |
| InChI | InChI=1S/C14H9ClN2OS/c15-13-9-6-5-8(14(16)18)7-12(9)19-11-4-2-1-3-10(11)17-13/h1-7H,(H2,16,18) |
| InChIKey | CFAYVEKKGDHRJA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |