C11H8F3NO2 — CID 142829685
5-methyl-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione (PubChem CID 142829685) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 5-methyl-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione.
| Compound Name | 5-methyl-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142829685 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-methyl-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(F)(F)F)C2=O |
| InChI | InChI=1S/C11H8F3NO2/c1-6-2-3-7-8(4-6)10(17)15(9(7)16)5-11(12,13)14/h2-4H,5H2,1H3 |
| InChIKey | AZGSCMZIKSMGEP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|