C37H54Br2N4O4 — CID 11828808
[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide (PubChem CID 11828808) has the molecular formula C37H54Br2N4O4 and a molecular weight of 778.67 g/mol. Its IUPAC name is [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide.
| Compound Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 11828808 |
| Molecular Formula | C37H54Br2N4O4 |
| Molecular Weight | 778.67 g/mol |
| Exact Mass | 776.25 |
| IUPAC Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[[3-(1,3-dioxoisoindol-2-yl)-2,2-dimethylpropyl]-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(C)(C)C[N+](C)(C)CCCCCC[N+](C)(C)CC(C)(C)CN1C(=O)c3ccccc3C1=O)C2=O.[Br-].[Br-] |
| InChI | InChI=1S/C37H54N4O4.2BrH/c1-27-18-19-30-31(22-27)35(45)39(34(30)44)24-37(4,5)26-41(8,9)21-15-11-10-14-20-40(6,7)25-36(2,3)23-38-32(42)28-16-12-13-17-29(28)33(38)43;;/h12-13,16-19,22H,10-11,14-15,20-21,23-26H2,1-9H3;2*1H/q+2;;/p-2 |
| InChIKey | RYZOWOQKAAGDBB-UHFFFAOYSA-L |
| XLogP | -0.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.67 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|