C15H7Br2O2PS2 — CID 130429318
5,11-dibromo-2-oxo-2-phenyl-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraen-8-one (PubChem CID 130429318) has the molecular formula C15H7Br2O2PS2 and a molecular weight of 474.14 g/mol. Its IUPAC name is 5,11-dibromo-2-oxo-2-phenyl-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraen-8-one.
| Compound Name | 5,11-dibromo-2-oxo-2-phenyl-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraen-8-one |
|---|---|
| PubChem CID | 130429318 |
| Molecular Formula | C15H7Br2O2PS2 |
| Molecular Weight | 474.14 g/mol |
| Exact Mass | 471.80 |
| IUPAC Name | 5,11-dibromo-2-oxo-2-phenyl-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraen-8-one |
| SMILES | O=C1c2sc(Br)cc2P(=O)(c2ccccc2)c2cc(Br)sc21 |
| InChI | InChI=1S/C15H7Br2O2PS2/c16-11-6-9-14(21-11)13(18)15-10(7-12(17)22-15)20(9,19)8-4-2-1-3-5-8/h1-7H |
| InChIKey | BXFCWTGYXDNKJP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|