About 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide
3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide (PubChem CID 122684935) has the molecular formula C20H13BrClOP
and a molecular weight of 415.65 g/mol. Its IUPAC name is 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide.
Molecular Properties
| Compound Name | 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide |
| PubChem CID | 122684935 |
| Molecular Formula | C20H13BrClOP |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide |
| SMILES | O=P1(c2ccccc2)C(c2ccc(Cl)cc2)=C(Br)c2ccccc21 |
| InChI | InChI=1S/C20H13BrClOP/c21-19-17-8-4-5-9-18(17)24(23,16-6-2-1-3-7-16)20(19)14-10-12-15(22)13-11-14/h1-13H |
| InChIKey | FBBZAFAFHICSED-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide?
The IUPAC name of 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide (CID 122684935) is 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide.
What is the SMILES notation for 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide?
The canonical SMILES for 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide is O=P1(c2ccccc2)C(c2ccc(Cl)cc2)=C(Br)c2ccccc21.
What is the InChIKey of 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide?
The InChIKey is FBBZAFAFHICSED-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13BrClOP/c21-19-17-8-4-5-9-18(17)24(23,16-6-2-1-3-7-16)20(19)14-10-12-15(22)13-11-14/h1-13H.
What are the key properties of 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide?
3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide has a molecular weight of 415.65 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(4-chlorophenyl)-1-phenylphosphindole 1-oxide is sourced from PubChem (CID 122684935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).