C29H28N3OP — CID 102499198
4-[1,2-bis[4-(methylamino)phenyl]-1-oxophosphindol-3-yl]-N-methylaniline (PubChem CID 102499198) has the molecular formula C29H28N3OP and a molecular weight of 465.54 g/mol. Its IUPAC name is 4-[1,2-bis[4-(methylamino)phenyl]-1-oxophosphindol-3-yl]-N-methylaniline.
| Compound Name | 4-[1,2-bis[4-(methylamino)phenyl]-1-oxophosphindol-3-yl]-N-methylaniline |
|---|---|
| PubChem CID | 102499198 |
| Molecular Formula | C29H28N3OP |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-[1,2-bis[4-(methylamino)phenyl]-1-oxophosphindol-3-yl]-N-methylaniline |
| SMILES | CNc1ccc(C2=C(c3ccc(NC)cc3)P(=O)(c3ccc(NC)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H28N3OP/c1-30-22-12-8-20(9-13-22)28-26-6-4-5-7-27(26)34(33,25-18-16-24(32-3)17-19-25)29(28)21-10-14-23(31-2)15-11-21/h4-19,30-32H,1-3H3 |
| InChIKey | DXUINOWIFPECNC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|