About (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide
(1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide (PubChem CID 132548466) has the molecular formula C16H12ClOP
and a molecular weight of 286.70 g/mol. Its IUPAC name is (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide.
Molecular Properties
| Compound Name | (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide |
| PubChem CID | 132548466 |
| Molecular Formula | C16H12ClOP |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide |
| SMILES | O=[P@]1(c2ccccc2)C=CC(c2ccc(Cl)cc2)=C1 |
| InChI | InChI=1S/C16H12ClOP/c17-15-8-6-13(7-9-15)14-10-11-19(18,12-14)16-4-2-1-3-5-16/h1-12H/t19-/m1/s1 |
| InChIKey | MINOILWNGDJUDB-LJQANCHMSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide?
The IUPAC name of (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide (CID 132548466) is (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide.
What is the SMILES notation for (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide?
The canonical SMILES for (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide is O=[P@]1(c2ccccc2)C=CC(c2ccc(Cl)cc2)=C1.
What is the InChIKey of (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide?
The InChIKey is MINOILWNGDJUDB-LJQANCHMSA-N. The full InChI is InChI=1S/C16H12ClOP/c17-15-8-6-13(7-9-15)14-10-11-19(18,12-14)16-4-2-1-3-5-16/h1-12H/t19-/m1/s1.
What are the key properties of (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide?
(1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide has a molecular weight of 286.70 g/mol, XLogP of 4.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-(4-chlorophenyl)-1-phenyl-1λ5-phosphole 1-oxide is sourced from PubChem (CID 132548466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).