C45H42NO3P3 — CID 153424856
8,14,22-triphenyl-5,11,17-tri(propan-2-yl)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene 8,14,22-trioxide (PubChem CID 153424856) has the molecular formula C45H42NO3P3 and a molecular weight of 737.76 g/mol. Its IUPAC name is 8,14,22-triphenyl-5,11,17-tri(propan-2-yl)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene 8,14,22-trioxide.
| Compound Name | 8,14,22-triphenyl-5,11,17-tri(propan-2-yl)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene 8,14,22-trioxide |
|---|---|
| PubChem CID | 153424856 |
| Molecular Formula | C45H42NO3P3 |
| Molecular Weight | 737.76 g/mol |
| Exact Mass | 737.24 |
| IUPAC Name | 8,14,22-triphenyl-5,11,17-tri(propan-2-yl)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene 8,14,22-trioxide |
| SMILES | CC(C)c1cc2c3c(c1)P(=O)(c1ccccc1)c1cc(C(C)C)cc4c1N3c1c(cc(C(C)C)cc1P4(=O)c1ccccc1)P2(=O)c1ccccc1 |
| InChI | InChI=1S/C45H42NO3P3/c1-28(2)31-22-37-43-38(23-31)51(48,35-18-12-8-13-19-35)40-25-33(30(5)6)27-42-45(40)46(43)44-39(50(37,47)34-16-10-7-11-17-34)24-32(29(3)4)26-41(44)52(42,49)36-20-14-9-15-21-36/h7-30H,1-6H3 |
| InChIKey | DTOFGFGFSITZQN-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.76 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|