C12H15Br2OP — CID 102258017
2,3-dibromo-3,4-dimethyl-1-phenyl-1λ5-phospholane 1-oxide (PubChem CID 102258017) has the molecular formula C12H15Br2OP and a molecular weight of 366.03 g/mol. Its IUPAC name is 2,3-dibromo-3,4-dimethyl-1-phenyl-1λ5-phospholane 1-oxide.
| Compound Name | 2,3-dibromo-3,4-dimethyl-1-phenyl-1λ5-phospholane 1-oxide |
|---|---|
| PubChem CID | 102258017 |
| Molecular Formula | C12H15Br2OP |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2,3-dibromo-3,4-dimethyl-1-phenyl-1λ5-phospholane 1-oxide |
| SMILES | CC1CP(=O)(c2ccccc2)C(Br)C1(C)Br |
| InChI | InChI=1S/C12H15Br2OP/c1-9-8-16(15,11(13)12(9,2)14)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
| InChIKey | RUFLBUJHZBQMDE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|