C15H19OP — CID 23422023
(1R,3aS,6aS)-3a,4-dimethyl-1-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]phosphole 1-oxide (PubChem CID 23422023) has the molecular formula C15H19OP and a molecular weight of 246.29 g/mol. Its IUPAC name is (1R,3aS,6aS)-3a,4-dimethyl-1-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]phosphole 1-oxide.
| Compound Name | (1R,3aS,6aS)-3a,4-dimethyl-1-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]phosphole 1-oxide |
|---|---|
| PubChem CID | 23422023 |
| Molecular Formula | C15H19OP |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (1R,3aS,6aS)-3a,4-dimethyl-1-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]phosphole 1-oxide |
| SMILES | CC1CC[C@H]2[C@]1(C)C=C[P@]2(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19OP/c1-12-8-9-14-15(12,2)10-11-17(14,16)13-6-4-3-5-7-13/h3-7,10-12,14H,8-9H2,1-2H3/t12?,14-,15+,17-/m0/s1 |
| InChIKey | SKEJKEREFFELFO-WNLZPSQYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|