About 6-benzyl-3,3-dimethylpiperazin-2-one
6-benzyl-3,3-dimethylpiperazin-2-one (PubChem CID 91187776) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-benzyl-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 6-benzyl-3,3-dimethylpiperazin-2-one |
| PubChem CID | 91187776 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 6-benzyl-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)NCC(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C13H18N2O/c1-13(2)12(16)15-11(9-14-13)8-10-6-4-3-5-7-10/h3-7,11,14H,8-9H2,1-2H3,(H,15,16) |
| InChIKey | URWDEPHZHXZOIZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-benzyl-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3,3-dimethylpiperazin-2-one?
The IUPAC name of 6-benzyl-3,3-dimethylpiperazin-2-one (CID 91187776) is 6-benzyl-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 6-benzyl-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 6-benzyl-3,3-dimethylpiperazin-2-one is CC1(C)NCC(Cc2ccccc2)NC1=O.
What is the InChIKey of 6-benzyl-3,3-dimethylpiperazin-2-one?
The InChIKey is URWDEPHZHXZOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-13(2)12(16)15-11(9-14-13)8-10-6-4-3-5-7-10/h3-7,11,14H,8-9H2,1-2H3,(H,15,16).
What are the key properties of 6-benzyl-3,3-dimethylpiperazin-2-one?
6-benzyl-3,3-dimethylpiperazin-2-one has a molecular weight of 218.30 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 91187776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).