About 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one
8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one (PubChem CID 91595061) has the molecular formula C16H22N2O
and a molecular weight of 258.37 g/mol. Its IUPAC name is 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one.
Molecular Properties
| Compound Name | 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one |
| PubChem CID | 91595061 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one |
| SMILES | CN1CC(Cc2ccccc2)NC(=O)C12CCCC2 |
| InChI | InChI=1S/C16H22N2O/c1-18-12-14(11-13-7-3-2-4-8-13)17-15(19)16(18)9-5-6-10-16/h2-4,7-8,14H,5-6,9-12H2,1H3,(H,17,19) |
| InChIKey | PJSXBDLHDOZHDJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one?
The IUPAC name of 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one (CID 91595061) is 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one.
What is the SMILES notation for 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one?
The canonical SMILES for 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one is CN1CC(Cc2ccccc2)NC(=O)C12CCCC2.
What is the InChIKey of 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one?
The InChIKey is PJSXBDLHDOZHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O/c1-18-12-14(11-13-7-3-2-4-8-13)17-15(19)16(18)9-5-6-10-16/h2-4,7-8,14H,5-6,9-12H2,1H3,(H,17,19).
What are the key properties of 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one?
8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one has a molecular weight of 258.37 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-6-methyl-6,9-diazaspiro[4.5]decan-10-one is sourced from PubChem (CID 91595061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).