C15H24N2O — CID 64858991
3-benzyl-1-(2-methoxyethyl)-1,4-diazepane (PubChem CID 64858991) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-benzyl-1-(2-methoxyethyl)-1,4-diazepane.
| Compound Name | 3-benzyl-1-(2-methoxyethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64858991 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-benzyl-1-(2-methoxyethyl)-1,4-diazepane |
| SMILES | COCCN1CCCNC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H24N2O/c1-18-11-10-17-9-5-8-16-15(13-17)12-14-6-3-2-4-7-14/h2-4,6-7,15-16H,5,8-13H2,1H3 |
| InChIKey | UWMXKPJJCYJFFE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |