C19H30N2 — CID 64945183
3-benzyl-1-(2-cyclopentylethyl)-1,4-diazepane (PubChem CID 64945183) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-benzyl-1-(2-cyclopentylethyl)-1,4-diazepane.
| Compound Name | 3-benzyl-1-(2-cyclopentylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64945183 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3-benzyl-1-(2-cyclopentylethyl)-1,4-diazepane |
| SMILES | c1ccc(CC2CN(CCC3CCCC3)CCCN2)cc1 |
| InChI | InChI=1S/C19H30N2/c1-2-9-18(10-3-1)15-19-16-21(13-6-12-20-19)14-11-17-7-4-5-8-17/h1-3,9-10,17,19-20H,4-8,11-16H2 |
| InChIKey | VAWFMVPHHBVBQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |