C14H22N2O — CID 82243271
[4-(2-phenylethyl)-1,4-diazepan-2-yl]methanol (PubChem CID 82243271) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is [4-(2-phenylethyl)-1,4-diazepan-2-yl]methanol.
| Compound Name | [4-(2-phenylethyl)-1,4-diazepan-2-yl]methanol |
|---|---|
| PubChem CID | 82243271 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [4-(2-phenylethyl)-1,4-diazepan-2-yl]methanol |
| SMILES | OCC1CN(CCc2ccccc2)CCCN1 |
| InChI | InChI=1S/C14H22N2O/c17-12-14-11-16(9-4-8-15-14)10-7-13-5-2-1-3-6-13/h1-3,5-6,14-15,17H,4,7-12H2 |
| InChIKey | LINSCTRLRHBNQZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |