C20H26N2 — CID 82251351
3-benzyl-1-[(4-methylphenyl)methyl]-1,4-diazepane (PubChem CID 82251351) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-benzyl-1-[(4-methylphenyl)methyl]-1,4-diazepane.
| Compound Name | 3-benzyl-1-[(4-methylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 82251351 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-benzyl-1-[(4-methylphenyl)methyl]-1,4-diazepane |
| SMILES | Cc1ccc(CN2CCCNC(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H26N2/c1-17-8-10-19(11-9-17)15-22-13-5-12-21-20(16-22)14-18-6-3-2-4-7-18/h2-4,6-11,20-21H,5,12-16H2,1H3 |
| InChIKey | PZHPKQPBULHRCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |