C15H24N2 — CID 64871903
3-ethyl-1-[(3-methylphenyl)methyl]-1,4-diazepane (PubChem CID 64871903) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-ethyl-1-[(3-methylphenyl)methyl]-1,4-diazepane.
| Compound Name | 3-ethyl-1-[(3-methylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64871903 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-ethyl-1-[(3-methylphenyl)methyl]-1,4-diazepane |
| SMILES | CCC1CN(Cc2cccc(C)c2)CCCN1 |
| InChI | InChI=1S/C15H24N2/c1-3-15-12-17(9-5-8-16-15)11-14-7-4-6-13(2)10-14/h4,6-7,10,15-16H,3,5,8-9,11-12H2,1-2H3 |
| InChIKey | FJNXTAQMCYAHPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |