C21H28N2O2 — CID 64885843
6-benzyl-8-cyclohexyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64885843) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 6-benzyl-8-cyclohexyl-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 6-benzyl-8-cyclohexyl-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64885843 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 6-benzyl-8-cyclohexyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | O=C1C(C2CCCCC2)NC(=O)C2(CCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c24-19-18(17-11-5-2-6-12-17)22-20(25)21(13-7-8-14-21)23(19)15-16-9-3-1-4-10-16/h1,3-4,9-10,17-18H,2,5-8,11-15H2,(H,22,25) |
| InChIKey | IIBXBFRQCVNREC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |