C15H24N2O2 — CID 64885846
8-cyclohexyl-6-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64885846) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 8-cyclohexyl-6-methyl-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 8-cyclohexyl-6-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64885846 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 8-cyclohexyl-6-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CN1C(=O)C(C2CCCCC2)NC(=O)C12CCCC2 |
| InChI | InChI=1S/C15H24N2O2/c1-17-13(18)12(11-7-3-2-4-8-11)16-14(19)15(17)9-5-6-10-15/h11-12H,2-10H2,1H3,(H,16,19) |
| InChIKey | UIFYYBQUUPRICS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |