C19H23N3O3 — CID 165427416
1-benzyl-8-(cyclobutanecarbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165427416) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-benzyl-8-(cyclobutanecarbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(cyclobutanecarbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165427416 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-benzyl-8-(cyclobutanecarbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(C1CCC1)N1CCC2(CC1)C(=O)NC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c23-16(15-7-4-8-15)21-11-9-19(10-12-21)17(24)20-18(25)22(19)13-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,20,24,25) |
| InChIKey | ZFOQGVXXUMAZBE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|