C18H24N4O5S — CID 165418331
1-benzyl-8-morpholin-4-ylsulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165418331) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-benzyl-8-morpholin-4-ylsulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-morpholin-4-ylsulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165418331 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-benzyl-8-morpholin-4-ylsulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(S(=O)(=O)N3CCOCC3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N4O5S/c23-16-18(22(17(24)19-16)14-15-4-2-1-3-5-15)6-8-20(9-7-18)28(25,26)21-10-12-27-13-11-21/h1-5H,6-14H2,(H,19,23,24) |
| InChIKey | QBSGGAAKMWVCJE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|