C18H18N4O4 — CID 165424928
1-benzyl-8-(1,2-oxazole-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165424928) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-benzyl-8-(1,2-oxazole-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(1,2-oxazole-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165424928 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-benzyl-8-(1,2-oxazole-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(c1ccon1)N1CCC2(CC1)C(=O)NC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C18H18N4O4/c23-15(14-6-11-26-20-14)21-9-7-18(8-10-21)16(24)19-17(25)22(18)12-13-4-2-1-3-5-13/h1-6,11H,7-10,12H2,(H,19,24,25) |
| InChIKey | WMFRUSMDBVGJFO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|