C21H22N6O3 — CID 165427848
1-benzyl-8-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165427848) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 1-benzyl-8-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165427848 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-benzyl-8-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1ccn2ncc(C(=O)N3CCC4(CC3)C(=O)NC(=O)N4Cc3ccccc3)c12 |
| InChI | InChI=1S/C21H22N6O3/c1-24-11-12-27-17(24)16(13-22-27)18(28)25-9-7-21(8-10-25)19(29)23-20(30)26(21)14-15-5-3-2-4-6-15/h2-6,11-13H,7-10,14H2,1H3,(H,23,29,30) |
| InChIKey | IKPCLOAUTBYNNS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|