C22H25N5O3 — CID 162638934
1-(3-methoxypropyl)-1'-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)spiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 162638934) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-1'-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)spiro[indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1-(3-methoxypropyl)-1'-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)spiro[indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 162638934 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-(3-methoxypropyl)-1'-(1-methylimidazo[2,1-e]pyrazole-7-carbonyl)spiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | COCCCN1C(=O)C2(CCN(C(=O)c3cnn4ccn(C)c34)C2)c2ccccc21 |
| InChI | InChI=1S/C22H25N5O3/c1-24-11-12-27-19(24)16(14-23-27)20(28)25-10-8-22(15-25)17-6-3-4-7-18(17)26(21(22)29)9-5-13-30-2/h3-4,6-7,11-12,14H,5,8-10,13,15H2,1-2H3 |
| InChIKey | GAKSMCLDJGBZPX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|