C21H21N7O2 — CID 164694389
1-benzyl-8-(1-phenyltetrazol-5-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 164694389) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 1-benzyl-8-(1-phenyltetrazol-5-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(1-phenyltetrazol-5-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 164694389 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-benzyl-8-(1-phenyltetrazol-5-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(c3nnnn3-c3ccccc3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H21N7O2/c29-18-21(27(20(30)22-18)15-16-7-3-1-4-8-16)11-13-26(14-12-21)19-23-24-25-28(19)17-9-5-2-6-10-17/h1-10H,11-15H2,(H,22,29,30) |
| InChIKey | JFFQBJBBXFPWCL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|