C23H23N7O3 — CID 55600868
1-[[4-[4-(1-phenyltetrazol-5-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 55600868) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-[[4-[4-(1-phenyltetrazol-5-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[4-(1-phenyltetrazol-5-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55600868 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[[4-[4-(1-phenyltetrazol-5-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(CN2C(=O)CCC2=O)cc1)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23N7O3/c31-20-10-11-21(32)29(20)16-17-6-8-18(9-7-17)22(33)27-12-14-28(15-13-27)23-24-25-26-30(23)19-4-2-1-3-5-19/h1-9H,10-16H2 |
| InChIKey | QWYWYKYEHHBTQQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|