C19H18F2N6O3S — CID 55601318
[4-(difluoromethylsulfonyl)phenyl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone (PubChem CID 55601318) has the molecular formula C19H18F2N6O3S and a molecular weight of 448.46 g/mol. Its IUPAC name is [4-(difluoromethylsulfonyl)phenyl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone.
| Compound Name | [4-(difluoromethylsulfonyl)phenyl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55601318 |
| Molecular Formula | C19H18F2N6O3S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [4-(difluoromethylsulfonyl)phenyl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)F)cc1)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18F2N6O3S/c20-18(21)31(29,30)16-8-6-14(7-9-16)17(28)25-10-12-26(13-11-25)19-22-23-24-27(19)15-4-2-1-3-5-15/h1-9,18H,10-13H2 |
| InChIKey | GPSHJLNYEPWKAA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |