C20H22N6O4S — CID 26451946
ethyl 4-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 26451946) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is ethyl 4-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 26451946 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | ethyl 4-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(c3nnnn3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H22N6O4S/c1-2-30-19(27)16-8-10-18(11-9-16)31(28,29)25-14-12-24(13-15-25)20-21-22-23-26(20)17-6-4-3-5-7-17/h3-11H,2,12-15H2,1H3 |
| InChIKey | SAKFWHBEISFNLE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |