C22H29N3O5 — CID 166613134
1-benzyl-3-(2-hydroxyethyl)-8-(oxane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166613134) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-benzyl-3-(2-hydroxyethyl)-8-(oxane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-3-(2-hydroxyethyl)-8-(oxane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166613134 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-benzyl-3-(2-hydroxyethyl)-8-(oxane-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(C1CCCOC1)N1CCC2(CC1)C(=O)N(CCO)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H29N3O5/c26-13-12-24-20(28)22(25(21(24)29)15-17-5-2-1-3-6-17)8-10-23(11-9-22)19(27)18-7-4-14-30-16-18/h1-3,5-6,18,26H,4,7-16H2 |
| InChIKey | KRUNNEIEQHYYNE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|