C21H24N4O5 — CID 165428107
1-benzyl-3-(2-methoxyethyl)-8-(1,2-oxazole-5-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165428107) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-benzyl-3-(2-methoxyethyl)-8-(1,2-oxazole-5-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-3-(2-methoxyethyl)-8-(1,2-oxazole-5-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165428107 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-benzyl-3-(2-methoxyethyl)-8-(1,2-oxazole-5-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN1C(=O)N(Cc2ccccc2)C2(CCN(C(=O)c3ccno3)CC2)C1=O |
| InChI | InChI=1S/C21H24N4O5/c1-29-14-13-24-19(27)21(25(20(24)28)15-16-5-3-2-4-6-16)8-11-23(12-9-21)18(26)17-7-10-22-30-17/h2-7,10H,8-9,11-15H2,1H3 |
| InChIKey | YBOHQSMBFRXDSE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|