C28H31N3O4 — CID 26232504
1-benzyl-8-[[4-(furan-2-yl)phenyl]methyl]-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26232504) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 1-benzyl-8-[[4-(furan-2-yl)phenyl]methyl]-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-[[4-(furan-2-yl)phenyl]methyl]-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26232504 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-benzyl-8-[[4-(furan-2-yl)phenyl]methyl]-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN1C(=O)N(Cc2ccccc2)C2(CCN(Cc3ccc(-c4ccco4)cc3)CC2)C1=O |
| InChI | InChI=1S/C28H31N3O4/c1-34-19-17-30-26(32)28(31(27(30)33)21-22-6-3-2-4-7-22)13-15-29(16-14-28)20-23-9-11-24(12-10-23)25-8-5-18-35-25/h2-12,18H,13-17,19-21H2,1H3 |
| InChIKey | CUMYCOYOJUYORT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|