C20H26N2O3 — CID 97397082
1-benzyl-8-[(2R)-oxolane-2-carbonyl]-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97397082) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-benzyl-8-[(2R)-oxolane-2-carbonyl]-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-benzyl-8-[(2R)-oxolane-2-carbonyl]-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97397082 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-benzyl-8-[(2R)-oxolane-2-carbonyl]-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C([C@H]1CCCO1)N1CCC2(CCC(=O)N2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2O3/c23-18-8-9-20(22(18)15-16-5-2-1-3-6-16)10-12-21(13-11-20)19(24)17-7-4-14-25-17/h1-3,5-6,17H,4,7-15H2/t17-/m1/s1 |
| InChIKey | SFQYIQRNWXEWIM-QGZVFWFLSA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |