C23H30N2O2 — CID 26344303
1-benzyl-8-[2-(cyclohexen-1-yl)acetyl]-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 26344303) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-benzyl-8-[2-(cyclohexen-1-yl)acetyl]-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-benzyl-8-[2-(cyclohexen-1-yl)acetyl]-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 26344303 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-benzyl-8-[2-(cyclohexen-1-yl)acetyl]-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C(CC1=CCCCC1)N1CCC2(CCC(=O)N2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c26-21-11-12-23(25(21)18-20-9-5-2-6-10-20)13-15-24(16-14-23)22(27)17-19-7-3-1-4-8-19/h2,5-7,9-10H,1,3-4,8,11-18H2 |
| InChIKey | DALPSORAMRGHNT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|