C21H26N4O2 — CID 91922556
2-benzyl-7-[2-(cyclohexen-1-yl)acetyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one (PubChem CID 91922556) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-benzyl-7-[2-(cyclohexen-1-yl)acetyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one.
| Compound Name | 2-benzyl-7-[2-(cyclohexen-1-yl)acetyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
|---|---|
| PubChem CID | 91922556 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-benzyl-7-[2-(cyclohexen-1-yl)acetyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-one |
| SMILES | O=C(CC1=CCCCC1)N1CCc2nn(Cc3ccccc3)c(=O)n2CC1 |
| InChI | InChI=1S/C21H26N4O2/c26-20(15-17-7-3-1-4-8-17)23-12-11-19-22-25(21(27)24(19)14-13-23)16-18-9-5-2-6-10-18/h2,5-7,9-10H,1,3-4,8,11-16H2 |
| InChIKey | HDXVJABRERKGNN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|