C12H13N3O4 — CID 62937679
5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]furan-2-carboxylic acid (PubChem CID 62937679) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62937679 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2nc3n(c2=O)CCCC3)o1 |
| InChI | InChI=1S/C12H13N3O4/c16-11(17)9-5-4-8(19-9)7-15-12(18)14-6-2-1-3-10(14)13-15/h4-5H,1-3,6-7H2,(H,16,17) |
| InChIKey | HNXRQTGODUTKAE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |