C15H25NO — CID 174976143
1,2,2,3-tetramethyl-6-phenylpiperidine;hydrate (PubChem CID 174976143) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-6-phenylpiperidine;hydrate.
| Compound Name | 1,2,2,3-tetramethyl-6-phenylpiperidine;hydrate |
|---|---|
| PubChem CID | 174976143 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1,2,2,3-tetramethyl-6-phenylpiperidine;hydrate |
| SMILES | CC1CCC(c2ccccc2)N(C)C1(C)C.O |
| InChI | InChI=1S/C15H23N.H2O/c1-12-10-11-14(16(4)15(12,2)3)13-8-6-5-7-9-13;/h5-9,12,14H,10-11H2,1-4H3;1H2 |
| InChIKey | ASKRREUCDCJXDX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |