C10H14N3- — CID 163468254
(3S,5R)-3-methyl-5-phenylpyrazolidin-2-id-1-amine (PubChem CID 163468254) has the molecular formula C10H14N3- and a molecular weight of 176.24 g/mol. Its IUPAC name is (3S,5R)-3-methyl-5-phenylpyrazolidin-2-id-1-amine.
| Compound Name | (3S,5R)-3-methyl-5-phenylpyrazolidin-2-id-1-amine |
|---|---|
| PubChem CID | 163468254 |
| Molecular Formula | C10H14N3- |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (3S,5R)-3-methyl-5-phenylpyrazolidin-2-id-1-amine |
| SMILES | C[C@H]1C[C@H](c2ccccc2)N(N)[N-]1 |
| InChI | InChI=1S/C10H14N3/c1-8-7-10(13(11)12-8)9-5-3-2-4-6-9/h2-6,8,10H,7,11H2,1H3/q-1/t8-,10+/m0/s1 |
| InChIKey | ZFZVWELZFPIMHX-WCBMZHEXSA-N |
| XLogP | 1.98 |
| TPSA | 43.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|