About 3-methyl-4-phenyl-1,3-oxazolidine
3-methyl-4-phenyl-1,3-oxazolidine (PubChem CID 19920145) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-methyl-4-phenyl-1,3-oxazolidine |
| PubChem CID | 19920145 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-methyl-4-phenyl-1,3-oxazolidine |
| SMILES | CN1COCC1c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-11-8-12-7-10(11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | RXGVOWHOMRHOMQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-phenyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-phenyl-1,3-oxazolidine?
The IUPAC name of 3-methyl-4-phenyl-1,3-oxazolidine (CID 19920145) is 3-methyl-4-phenyl-1,3-oxazolidine.
What is the SMILES notation for 3-methyl-4-phenyl-1,3-oxazolidine?
The canonical SMILES for 3-methyl-4-phenyl-1,3-oxazolidine is CN1COCC1c1ccccc1.
What is the InChIKey of 3-methyl-4-phenyl-1,3-oxazolidine?
The InChIKey is RXGVOWHOMRHOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-11-8-12-7-10(11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3.
What are the key properties of 3-methyl-4-phenyl-1,3-oxazolidine?
3-methyl-4-phenyl-1,3-oxazolidine has a molecular weight of 163.22 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-phenyl-1,3-oxazolidine is sourced from PubChem (CID 19920145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).