C10H13NO — CID 19920145
3-methyl-4-phenyl-1,3-oxazolidine (PubChem CID 19920145) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,3-oxazolidine.
| Compound Name | 3-methyl-4-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 19920145 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-methyl-4-phenyl-1,3-oxazolidine |
| SMILES | CN1COCC1c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-11-8-12-7-10(11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | RXGVOWHOMRHOMQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |