C19H22N2O2 — CID 14874965
(5R,10R)-5,10-diphenyl-3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane (PubChem CID 14874965) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (5R,10R)-5,10-diphenyl-3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane.
| Compound Name | (5R,10R)-5,10-diphenyl-3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane |
|---|---|
| PubChem CID | 14874965 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (5R,10R)-5,10-diphenyl-3,8-dioxa-1,6-diazabicyclo[4.4.1]undecane |
| SMILES | c1ccc([C@@H]2COCN3CN2COC[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-7-16(8-4-1)18-11-22-15-21-13-20(18)14-23-12-19(21)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2/t18-,19-/m0/s1 |
| InChIKey | WPFLPWMXKDEKIL-OALUTQOASA-N |
| XLogP | 3.01 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |