C21H19N3O — CID 132583061
phenyl-[4-(4-phenyl-1,3-oxazolidin-3-yl)phenyl]diazene (PubChem CID 132583061) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is phenyl-[4-(4-phenyl-1,3-oxazolidin-3-yl)phenyl]diazene.
| Compound Name | phenyl-[4-(4-phenyl-1,3-oxazolidin-3-yl)phenyl]diazene |
|---|---|
| PubChem CID | 132583061 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | phenyl-[4-(4-phenyl-1,3-oxazolidin-3-yl)phenyl]diazene |
| SMILES | c1ccc(/N=N/c2ccc(N3COCC3c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H19N3O/c1-3-7-17(8-4-1)21-15-25-16-24(21)20-13-11-19(12-14-20)23-22-18-9-5-2-6-10-18/h1-14,21H,15-16H2/b23-22+ |
| InChIKey | YGUCNRYNKKSHDQ-GHVJWSGMSA-N |
| XLogP | 5.64 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|