About 1-methyl-2-phenylazepane
1-methyl-2-phenylazepane (PubChem CID 23447707) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-methyl-2-phenylazepane.
Molecular Properties
| Compound Name | 1-methyl-2-phenylazepane |
| PubChem CID | 23447707 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-methyl-2-phenylazepane |
| SMILES | CN1CCCCCC1c1ccccc1 |
| InChI | InChI=1S/C13H19N/c1-14-11-7-3-6-10-13(14)12-8-4-2-5-9-12/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3 |
| InChIKey | RJJRKJKPLQICGT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2-phenylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-phenylazepane?
The IUPAC name of 1-methyl-2-phenylazepane (CID 23447707) is 1-methyl-2-phenylazepane.
What is the SMILES notation for 1-methyl-2-phenylazepane?
The canonical SMILES for 1-methyl-2-phenylazepane is CN1CCCCCC1c1ccccc1.
What is the InChIKey of 1-methyl-2-phenylazepane?
The InChIKey is RJJRKJKPLQICGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-14-11-7-3-6-10-13(14)12-8-4-2-5-9-12/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3.
What are the key properties of 1-methyl-2-phenylazepane?
1-methyl-2-phenylazepane has a molecular weight of 189.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-phenylazepane is sourced from PubChem (CID 23447707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).