About 1-ethyl-2-phenylazepane
1-ethyl-2-phenylazepane (PubChem CID 59678181) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-ethyl-2-phenylazepane.
Molecular Properties
| Compound Name | 1-ethyl-2-phenylazepane |
| PubChem CID | 59678181 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-ethyl-2-phenylazepane |
| SMILES | CCN1CCCCCC1c1ccccc1 |
| InChI | InChI=1S/C14H21N/c1-2-15-12-8-4-7-11-14(15)13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3 |
| InChIKey | FHAKFNRZDPIIRR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-2-phenylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-phenylazepane?
The IUPAC name of 1-ethyl-2-phenylazepane (CID 59678181) is 1-ethyl-2-phenylazepane.
What is the SMILES notation for 1-ethyl-2-phenylazepane?
The canonical SMILES for 1-ethyl-2-phenylazepane is CCN1CCCCCC1c1ccccc1.
What is the InChIKey of 1-ethyl-2-phenylazepane?
The InChIKey is FHAKFNRZDPIIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-2-15-12-8-4-7-11-14(15)13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3.
What are the key properties of 1-ethyl-2-phenylazepane?
1-ethyl-2-phenylazepane has a molecular weight of 203.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-phenylazepane is sourced from PubChem (CID 59678181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).