C24H26N2 — CID 123872639
N-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]-N-methylaniline (PubChem CID 123872639) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]-N-methylaniline.
| Compound Name | N-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]-N-methylaniline |
|---|---|
| PubChem CID | 123872639 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]-N-methylaniline |
| SMILES | CN(CN1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2/c1-25(22-15-9-4-10-16-22)19-26-23(20-11-5-2-6-12-20)17-18-24(26)21-13-7-3-8-14-21/h2-16,23-24H,17-19H2,1H3/t23-,24-/m1/s1 |
| InChIKey | VLUDANDBGHXADL-DNQXCXABSA-N |
| XLogP | 5.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |