C22H29N — CID 132552857
(2R,6S)-1-pentyl-2,6-diphenylpiperidine (PubChem CID 132552857) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is (2R,6S)-1-pentyl-2,6-diphenylpiperidine.
| Compound Name | (2R,6S)-1-pentyl-2,6-diphenylpiperidine |
|---|---|
| PubChem CID | 132552857 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (2R,6S)-1-pentyl-2,6-diphenylpiperidine |
| SMILES | CCCCCN1[C@@H](c2ccccc2)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H29N/c1-2-3-10-18-23-21(19-12-6-4-7-13-19)16-11-17-22(23)20-14-8-5-9-15-20/h4-9,12-15,21-22H,2-3,10-11,16-18H2,1H3/t21-,22+ |
| InChIKey | RFKNIVGKTPOLRL-SZPZYZBQSA-N |
| XLogP | 6.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|