C22H28N2 — CID 135077796
(E)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]hexan-1-imine (PubChem CID 135077796) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (E)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]hexan-1-imine.
| Compound Name | (E)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]hexan-1-imine |
|---|---|
| PubChem CID | 135077796 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (E)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]hexan-1-imine |
| SMILES | CCCCC/C=N/N1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H28N2/c1-2-3-4-11-18-23-24-21(19-12-7-5-8-13-19)16-17-22(24)20-14-9-6-10-15-20/h5-10,12-15,18,21-22H,2-4,11,16-17H2,1H3/b23-18+/t21-,22-/m0/s1 |
| InChIKey | CXGJWNWTZWGPBK-WMRXMYIESA-N |
| XLogP | 6.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|