C35H31N2P — CID 59052700
(E)-1-(2-diphenylphosphanylphenyl)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]methanimine (PubChem CID 59052700) has the molecular formula C35H31N2P and a molecular weight of 510.62 g/mol. Its IUPAC name is (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]methanimine.
| Compound Name | (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]methanimine |
|---|---|
| PubChem CID | 59052700 |
| Molecular Formula | C35H31N2P |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (E)-1-(2-diphenylphosphanylphenyl)-N-[(2S,5S)-2,5-diphenylpyrrolidin-1-yl]methanimine |
| SMILES | C(=N/N1[C@H](c2ccccc2)CC[C@H]1c1ccccc1)\c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31N2P/c1-5-15-28(16-6-1)33-25-26-34(29-17-7-2-8-18-29)37(33)36-27-30-19-13-14-24-35(30)38(31-20-9-3-10-21-31)32-22-11-4-12-23-32/h1-24,27,33-34H,25-26H2/b36-27+/t33-,34-/m0/s1 |
| InChIKey | JXQLHOLMNNMITG-YUYSSCBZSA-N |
| XLogP | 7.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|