C18H27NO — CID 10636009
(3R,5S,8aR)-5-pentyl-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 10636009) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (3R,5S,8aR)-5-pentyl-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3R,5S,8aR)-5-pentyl-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 10636009 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (3R,5S,8aR)-5-pentyl-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | CCCCC[C@H]1CCC[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C18H27NO/c1-2-3-5-11-16-12-8-13-18-19(16)17(14-20-18)15-9-6-4-7-10-15/h4,6-7,9-10,16-18H,2-3,5,8,11-14H2,1H3/t16-,17-,18+/m0/s1 |
| InChIKey | COBJUGSIBGVJEZ-OKZBNKHCSA-N |
| XLogP | 4.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|