C15H19NO — CID 3771762
3-phenyl-5-prop-2-enyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole (PubChem CID 3771762) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-phenyl-5-prop-2-enyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole.
| Compound Name | 3-phenyl-5-prop-2-enyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 3771762 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-phenyl-5-prop-2-enyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
| SMILES | C=CCC1CCC2OCC(c3ccccc3)N12 |
| InChI | InChI=1S/C15H19NO/c1-2-6-13-9-10-15-16(13)14(11-17-15)12-7-4-3-5-8-12/h2-5,7-8,13-15H,1,6,9-11H2 |
| InChIKey | DWVCBDSOQRSFNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|