C13H17NO — CID 134984155
(3R,5S)-2-methyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine (PubChem CID 134984155) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (3R,5S)-2-methyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-2-methyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134984155 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3R,5S)-2-methyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine |
| SMILES | C=CC[C@H]1C[C@H](c2ccccc2)N(C)O1 |
| InChI | InChI=1S/C13H17NO/c1-3-7-12-10-13(14(2)15-12)11-8-5-4-6-9-11/h3-6,8-9,12-13H,1,7,10H2,2H3/t12-,13+/m0/s1 |
| InChIKey | AXGHXDSFXICDCP-QWHCGFSZSA-N |
| XLogP | 2.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|